C10H19N — CID 170442257
(2R,6S)-2,6-dimethyl-4-propan-2-yl-1,2,3,6-tetrahydropyridine (PubChem CID 170442257) has the molecular formula C10H19N and a molecular weight of 153.27 g/mol. Its IUPAC name is (2R,6S)-2,6-dimethyl-4-propan-2-yl-1,2,3,6-tetrahydropyridine.
| Compound Name | (2R,6S)-2,6-dimethyl-4-propan-2-yl-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 170442257 |
| Molecular Formula | C10H19N |
| Molecular Weight | 153.27 g/mol |
| Exact Mass | 153.15 |
| IUPAC Name | (2R,6S)-2,6-dimethyl-4-propan-2-yl-1,2,3,6-tetrahydropyridine |
| SMILES | CC(C)C1=C[C@H](C)N[C@H](C)C1 |
| InChI | InChI=1S/C10H19N/c1-7(2)10-5-8(3)11-9(4)6-10/h5,7-9,11H,6H2,1-4H3/t8-,9+/m0/s1 |
| InChIKey | YEHXKWFTXSIFDK-DTWKUNHWSA-N |
| XLogP | 2.34 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.27 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|