C19H30O8 — CID 170442584
5-(3,3-dimethyl-2-oxopentyl)-10,11-dimethoxy-10,11-dimethyl-3,7,9,12-tetraoxatricyclo[6.4.0.02,6]dodecan-4-one (PubChem CID 170442584) has the molecular formula C19H30O8 and a molecular weight of 386.44 g/mol. Its IUPAC name is 5-(3,3-dimethyl-2-oxopentyl)-10,11-dimethoxy-10,11-dimethyl-3,7,9,12-tetraoxatricyclo[6.4.0.02,6]dodecan-4-one.
| Compound Name | 5-(3,3-dimethyl-2-oxopentyl)-10,11-dimethoxy-10,11-dimethyl-3,7,9,12-tetraoxatricyclo[6.4.0.02,6]dodecan-4-one |
|---|---|
| PubChem CID | 170442584 |
| Molecular Formula | C19H30O8 |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | 5-(3,3-dimethyl-2-oxopentyl)-10,11-dimethoxy-10,11-dimethyl-3,7,9,12-tetraoxatricyclo[6.4.0.02,6]dodecan-4-one |
| SMILES | CCC(C)(C)C(=O)CC1C(=O)OC2C3OC(C)(OC)C(C)(OC)OC3OC12 |
| InChI | InChI=1S/C19H30O8/c1-8-17(2,3)11(20)9-10-12-13(24-15(10)21)14-16(25-12)27-19(5,23-7)18(4,22-6)26-14/h10,12-14,16H,8-9H2,1-7H3 |
| InChIKey | IUOFCIZLHAFVOW-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |