C17H26O4S — CID 170442922
2,2-dimethyl-3-oxo-3-[2-(10-thiatricyclo[5.2.1.02,6]decan-8-yl)propan-2-yloxy]propanoic acid (PubChem CID 170442922) has the molecular formula C17H26O4S and a molecular weight of 326.46 g/mol. Its IUPAC name is 2,2-dimethyl-3-oxo-3-[2-(10-thiatricyclo[5.2.1.02,6]decan-8-yl)propan-2-yloxy]propanoic acid.
| Compound Name | 2,2-dimethyl-3-oxo-3-[2-(10-thiatricyclo[5.2.1.02,6]decan-8-yl)propan-2-yloxy]propanoic acid |
|---|---|
| PubChem CID | 170442922 |
| Molecular Formula | C17H26O4S |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | 2,2-dimethyl-3-oxo-3-[2-(10-thiatricyclo[5.2.1.02,6]decan-8-yl)propan-2-yloxy]propanoic acid |
| SMILES | CC(C)(C(=O)O)C(=O)OC(C)(C)C1CC2SC1C1CCCC21 |
| InChI | InChI=1S/C17H26O4S/c1-16(2,14(18)19)15(20)21-17(3,4)11-8-12-9-6-5-7-10(9)13(11)22-12/h9-13H,5-8H2,1-4H3,(H,18,19) |
| InChIKey | HJMMVBBGTAEGBI-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|