About 6-ethyl-4-methyl-[1,3]thiazolo[5,4-d]pyrimidine-5,7-dione
6-ethyl-4-methyl-[1,3]thiazolo[5,4-d]pyrimidine-5,7-dione (PubChem CID 170443471) has the molecular formula C8H9N3O2S
and a molecular weight of 211.25 g/mol. Its IUPAC name is 6-ethyl-4-methyl-[1,3]thiazolo[5,4-d]pyrimidine-5,7-dione.
Molecular Properties
| Compound Name | 6-ethyl-4-methyl-[1,3]thiazolo[5,4-d]pyrimidine-5,7-dione |
| PubChem CID | 170443471 |
| Molecular Formula | C8H9N3O2S |
| Molecular Weight | 211.25 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | 6-ethyl-4-methyl-[1,3]thiazolo[5,4-d]pyrimidine-5,7-dione |
| SMILES | CCn1c(=O)c2ncsc2n(C)c1=O |
| InChI | InChI=1S/C8H9N3O2S/c1-3-11-6(12)5-7(14-4-9-5)10(2)8(11)13/h4H,3H2,1-2H3 |
| InChIKey | MXQWYGGQIUGPGJ-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 56.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.25 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-ethyl-4-methyl-[1,3]thiazolo[5,4-d]pyrimidine-5,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-4-methyl-[1,3]thiazolo[5,4-d]pyrimidine-5,7-dione?
The IUPAC name of 6-ethyl-4-methyl-[1,3]thiazolo[5,4-d]pyrimidine-5,7-dione (CID 170443471) is 6-ethyl-4-methyl-[1,3]thiazolo[5,4-d]pyrimidine-5,7-dione.
What is the SMILES notation for 6-ethyl-4-methyl-[1,3]thiazolo[5,4-d]pyrimidine-5,7-dione?
The canonical SMILES for 6-ethyl-4-methyl-[1,3]thiazolo[5,4-d]pyrimidine-5,7-dione is CCn1c(=O)c2ncsc2n(C)c1=O.
What is the InChIKey of 6-ethyl-4-methyl-[1,3]thiazolo[5,4-d]pyrimidine-5,7-dione?
The InChIKey is MXQWYGGQIUGPGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O2S/c1-3-11-6(12)5-7(14-4-9-5)10(2)8(11)13/h4H,3H2,1-2H3.
What are the key properties of 6-ethyl-4-methyl-[1,3]thiazolo[5,4-d]pyrimidine-5,7-dione?
6-ethyl-4-methyl-[1,3]thiazolo[5,4-d]pyrimidine-5,7-dione has a molecular weight of 211.25 g/mol, XLogP of 0.18, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-4-methyl-[1,3]thiazolo[5,4-d]pyrimidine-5,7-dione is sourced from PubChem (CID 170443471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).