C12H11ClN4O6 — CID 170443493
(2-methoxy-2-oxoethyl) 2-[[5-(5-chloro-2-pyridinyl)-1-hydroxy-1,2,4-triazol-3-yl]oxy]acetate (PubChem CID 170443493) has the molecular formula C12H11ClN4O6 and a molecular weight of 342.70 g/mol. Its IUPAC name is (2-methoxy-2-oxoethyl) 2-[[5-(5-chloro-2-pyridinyl)-1-hydroxy-1,2,4-triazol-3-yl]oxy]acetate.
| Compound Name | (2-methoxy-2-oxoethyl) 2-[[5-(5-chloro-2-pyridinyl)-1-hydroxy-1,2,4-triazol-3-yl]oxy]acetate |
|---|---|
| PubChem CID | 170443493 |
| Molecular Formula | C12H11ClN4O6 |
| Molecular Weight | 342.70 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | (2-methoxy-2-oxoethyl) 2-[[5-(5-chloro-2-pyridinyl)-1-hydroxy-1,2,4-triazol-3-yl]oxy]acetate |
| SMILES | COC(=O)COC(=O)COc1nc(-c2ccc(Cl)cn2)n(O)n1 |
| InChI | InChI=1S/C12H11ClN4O6/c1-21-9(18)5-22-10(19)6-23-12-15-11(17(20)16-12)8-3-2-7(13)4-14-8/h2-4,20H,5-6H2,1H3 |
| InChIKey | XTTACHJUKCHESN-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 125.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.70 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|