C19H19N3O2S — CID 170443776
5-[(5aS,9aR)-4-methyl-6,7,8,9,9a,10-hexahydro-5aH-pyridazino[4,3-b][1,4]benzoxazin-3-yl]-1-benzothiophen-4-ol (PubChem CID 170443776) has the molecular formula C19H19N3O2S and a molecular weight of 353.45 g/mol. Its IUPAC name is 5-[(5aS,9aR)-4-methyl-6,7,8,9,9a,10-hexahydro-5aH-pyridazino[4,3-b][1,4]benzoxazin-3-yl]-1-benzothiophen-4-ol.
| Compound Name | 5-[(5aS,9aR)-4-methyl-6,7,8,9,9a,10-hexahydro-5aH-pyridazino[4,3-b][1,4]benzoxazin-3-yl]-1-benzothiophen-4-ol |
|---|---|
| PubChem CID | 170443776 |
| Molecular Formula | C19H19N3O2S |
| Molecular Weight | 353.45 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | 5-[(5aS,9aR)-4-methyl-6,7,8,9,9a,10-hexahydro-5aH-pyridazino[4,3-b][1,4]benzoxazin-3-yl]-1-benzothiophen-4-ol |
| SMILES | Cc1c(-c2ccc3sccc3c2O)nnc2c1O[C@H]1CCCC[C@H]1N2 |
| InChI | InChI=1S/C19H19N3O2S/c1-10-16(12-6-7-15-11(17(12)23)8-9-25-15)21-22-19-18(10)24-14-5-3-2-4-13(14)20-19/h6-9,13-14,23H,2-5H2,1H3,(H,20,22)/t13-,14+/m1/s1 |
| InChIKey | FZUCYAACJUVCMQ-KGLIPLIRSA-N |
| XLogP | 4.49 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.45 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |