C20H18ClFN4O4 — CID 170444071
N-[(1Z)-1-amino-1-chloro-3-methylbuta-1,3-dien-2-yl]-5-fluoro-2-hydroxy-4-(4-methyl-3-oxopyrido[3,2-b][1,4]oxazin-6-yl)benzamide (PubChem CID 170444071) has the molecular formula C20H18ClFN4O4 and a molecular weight of 432.84 g/mol. Its IUPAC name is N-[(1Z)-1-amino-1-chloro-3-methylbuta-1,3-dien-2-yl]-5-fluoro-2-hydroxy-4-(4-methyl-3-oxopyrido[3,2-b][1,4]oxazin-6-yl)benzamide.
| Compound Name | N-[(1Z)-1-amino-1-chloro-3-methylbuta-1,3-dien-2-yl]-5-fluoro-2-hydroxy-4-(4-methyl-3-oxopyrido[3,2-b][1,4]oxazin-6-yl)benzamide |
|---|---|
| PubChem CID | 170444071 |
| Molecular Formula | C20H18ClFN4O4 |
| Molecular Weight | 432.84 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | N-[(1Z)-1-amino-1-chloro-3-methylbuta-1,3-dien-2-yl]-5-fluoro-2-hydroxy-4-(4-methyl-3-oxopyrido[3,2-b][1,4]oxazin-6-yl)benzamide |
| SMILES | C=C(C)/C(NC(=O)c1cc(F)c(-c2ccc3c(n2)N(C)C(=O)CO3)cc1O)=C(\N)Cl |
| InChI | InChI=1S/C20H18ClFN4O4/c1-9(2)17(18(21)23)25-20(29)11-6-12(22)10(7-14(11)27)13-4-5-15-19(24-13)26(3)16(28)8-30-15/h4-7,27H,1,8,23H2,2-3H3,(H,25,29)/b18-17+ |
| InChIKey | SWPGLJWENKSZIX-ISLYRVAYSA-N |
| XLogP | 2.62 |
| TPSA | 117.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.84 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|