About 1-O-methyl 4-O-[1-(4-methylphenyl)cyclobutyl] 2-diethoxyphosphorylbutanedioate
1-O-methyl 4-O-[1-(4-methylphenyl)cyclobutyl] 2-diethoxyphosphorylbutanedioate (PubChem CID 170444120) has the molecular formula C20H29O7P
and a molecular weight of 412.42 g/mol. Its IUPAC name is 1-O-methyl 4-O-[1-(4-methylphenyl)cyclobutyl] 2-diethoxyphosphorylbutanedioate.
Molecular Properties
| Compound Name | 1-O-methyl 4-O-[1-(4-methylphenyl)cyclobutyl] 2-diethoxyphosphorylbutanedioate |
| PubChem CID | 170444120 |
| Molecular Formula | C20H29O7P |
| Molecular Weight | 412.42 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 1-O-methyl 4-O-[1-(4-methylphenyl)cyclobutyl] 2-diethoxyphosphorylbutanedioate |
| SMILES | CCOP(=O)(OCC)C(CC(=O)OC1(c2ccc(C)cc2)CCC1)C(=O)OC |
| InChI | InChI=1S/C20H29O7P/c1-5-25-28(23,26-6-2)17(19(22)24-4)14-18(21)27-20(12-7-13-20)16-10-8-15(3)9-11-16/h8-11,17H,5-7,12-14H2,1-4H3 |
| InChIKey | URYSDSICHHCHNN-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.42 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-O-methyl 4-O-[1-(4-methylphenyl)cyclobutyl] 2-diethoxyphosphorylbutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-methyl 4-O-[1-(4-methylphenyl)cyclobutyl] 2-diethoxyphosphorylbutanedioate?
The IUPAC name of 1-O-methyl 4-O-[1-(4-methylphenyl)cyclobutyl] 2-diethoxyphosphorylbutanedioate (CID 170444120) is 1-O-methyl 4-O-[1-(4-methylphenyl)cyclobutyl] 2-diethoxyphosphorylbutanedioate.
What is the SMILES notation for 1-O-methyl 4-O-[1-(4-methylphenyl)cyclobutyl] 2-diethoxyphosphorylbutanedioate?
The canonical SMILES for 1-O-methyl 4-O-[1-(4-methylphenyl)cyclobutyl] 2-diethoxyphosphorylbutanedioate is CCOP(=O)(OCC)C(CC(=O)OC1(c2ccc(C)cc2)CCC1)C(=O)OC.
What is the InChIKey of 1-O-methyl 4-O-[1-(4-methylphenyl)cyclobutyl] 2-diethoxyphosphorylbutanedioate?
The InChIKey is URYSDSICHHCHNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H29O7P/c1-5-25-28(23,26-6-2)17(19(22)24-4)14-18(21)27-20(12-7-13-20)16-10-8-15(3)9-11-16/h8-11,17H,5-7,12-14H2,1-4H3.
What are the key properties of 1-O-methyl 4-O-[1-(4-methylphenyl)cyclobutyl] 2-diethoxyphosphorylbutanedioate?
1-O-methyl 4-O-[1-(4-methylphenyl)cyclobutyl] 2-diethoxyphosphorylbutanedioate has a molecular weight of 412.42 g/mol, XLogP of 4.12, 10 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-methyl 4-O-[1-(4-methylphenyl)cyclobutyl] 2-diethoxyphosphorylbutanedioate is sourced from PubChem (CID 170444120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).