C29H37N3O4 — CID 170444137
2-[7-[[4-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]-N-methylhex-5-enamide (PubChem CID 170444137) has the molecular formula C29H37N3O4 and a molecular weight of 491.63 g/mol. Its IUPAC name is 2-[7-[[4-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]-N-methylhex-5-enamide.
| Compound Name | 2-[7-[[4-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]-N-methylhex-5-enamide |
|---|---|
| PubChem CID | 170444137 |
| Molecular Formula | C29H37N3O4 |
| Molecular Weight | 491.63 g/mol |
| Exact Mass | 491.28 |
| IUPAC Name | 2-[7-[[4-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]methoxy]-3-oxo-1H-isoindol-2-yl]-N-methylhex-5-enamide |
| SMILES | C=CCCC(C(=O)NC)N1Cc2c(OCc3ccc(CN4CC(C)OC(C)C4)cc3)cccc2C1=O |
| InChI | InChI=1S/C29H37N3O4/c1-5-6-9-26(28(33)30-4)32-18-25-24(29(32)34)8-7-10-27(25)35-19-23-13-11-22(12-14-23)17-31-15-20(2)36-21(3)16-31/h5,7-8,10-14,20-21,26H,1,6,9,15-19H2,2-4H3,(H,30,33) |
| InChIKey | WPCKBJUICJMCNX-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.63 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|