About N-methyl-N,2-bis(prop-2-enoxy)ethanamine
N-methyl-N,2-bis(prop-2-enoxy)ethanamine (PubChem CID 170444162) has the molecular formula C9H17NO2
and a molecular weight of 171.24 g/mol. Its IUPAC name is N-methyl-N,2-bis(prop-2-enoxy)ethanamine.
Molecular Properties
| Compound Name | N-methyl-N,2-bis(prop-2-enoxy)ethanamine |
| PubChem CID | 170444162 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | N-methyl-N,2-bis(prop-2-enoxy)ethanamine |
| SMILES | C=CCOCCN(C)OCC=C |
| InChI | InChI=1S/C9H17NO2/c1-4-7-11-9-6-10(3)12-8-5-2/h4-5H,1-2,6-9H2,3H3 |
| InChIKey | BUEFCOUBXXXWFN-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-N,2-bis(prop-2-enoxy)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N,2-bis(prop-2-enoxy)ethanamine?
The IUPAC name of N-methyl-N,2-bis(prop-2-enoxy)ethanamine (CID 170444162) is N-methyl-N,2-bis(prop-2-enoxy)ethanamine.
What is the SMILES notation for N-methyl-N,2-bis(prop-2-enoxy)ethanamine?
The canonical SMILES for N-methyl-N,2-bis(prop-2-enoxy)ethanamine is C=CCOCCN(C)OCC=C.
What is the InChIKey of N-methyl-N,2-bis(prop-2-enoxy)ethanamine?
The InChIKey is BUEFCOUBXXXWFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO2/c1-4-7-11-9-6-10(3)12-8-5-2/h4-5H,1-2,6-9H2,3H3.
What are the key properties of N-methyl-N,2-bis(prop-2-enoxy)ethanamine?
N-methyl-N,2-bis(prop-2-enoxy)ethanamine has a molecular weight of 171.24 g/mol, XLogP of 1.24, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N,2-bis(prop-2-enoxy)ethanamine is sourced from PubChem (CID 170444162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).