About 1-methylsulfonyl-4-(1,4,5-trimethylpyrazol-3-yl)oxypiperidine
1-methylsulfonyl-4-(1,4,5-trimethylpyrazol-3-yl)oxypiperidine (PubChem CID 170445430) has the molecular formula C12H21N3O3S
and a molecular weight of 287.38 g/mol. Its IUPAC name is 1-methylsulfonyl-4-(1,4,5-trimethylpyrazol-3-yl)oxypiperidine.
Molecular Properties
| Compound Name | 1-methylsulfonyl-4-(1,4,5-trimethylpyrazol-3-yl)oxypiperidine |
| PubChem CID | 170445430 |
| Molecular Formula | C12H21N3O3S |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 1-methylsulfonyl-4-(1,4,5-trimethylpyrazol-3-yl)oxypiperidine |
| SMILES | Cc1c(OC2CCN(S(C)(=O)=O)CC2)nn(C)c1C |
| InChI | InChI=1S/C12H21N3O3S/c1-9-10(2)14(3)13-12(9)18-11-5-7-15(8-6-11)19(4,16)17/h11H,5-8H2,1-4H3 |
| InChIKey | LURKNNCJBKLXTC-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-methylsulfonyl-4-(1,4,5-trimethylpyrazol-3-yl)oxypiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylsulfonyl-4-(1,4,5-trimethylpyrazol-3-yl)oxypiperidine?
The IUPAC name of 1-methylsulfonyl-4-(1,4,5-trimethylpyrazol-3-yl)oxypiperidine (CID 170445430) is 1-methylsulfonyl-4-(1,4,5-trimethylpyrazol-3-yl)oxypiperidine.
What is the SMILES notation for 1-methylsulfonyl-4-(1,4,5-trimethylpyrazol-3-yl)oxypiperidine?
The canonical SMILES for 1-methylsulfonyl-4-(1,4,5-trimethylpyrazol-3-yl)oxypiperidine is Cc1c(OC2CCN(S(C)(=O)=O)CC2)nn(C)c1C.
What is the InChIKey of 1-methylsulfonyl-4-(1,4,5-trimethylpyrazol-3-yl)oxypiperidine?
The InChIKey is LURKNNCJBKLXTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N3O3S/c1-9-10(2)14(3)13-12(9)18-11-5-7-15(8-6-11)19(4,16)17/h11H,5-8H2,1-4H3.
What are the key properties of 1-methylsulfonyl-4-(1,4,5-trimethylpyrazol-3-yl)oxypiperidine?
1-methylsulfonyl-4-(1,4,5-trimethylpyrazol-3-yl)oxypiperidine has a molecular weight of 287.38 g/mol, XLogP of 0.84, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylsulfonyl-4-(1,4,5-trimethylpyrazol-3-yl)oxypiperidine is sourced from PubChem (CID 170445430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).