About 2-[4,5-dimethyl-3-(1-methylsulfonylpiperidin-4-yl)oxypyrazol-1-yl]ethanol
2-[4,5-dimethyl-3-(1-methylsulfonylpiperidin-4-yl)oxypyrazol-1-yl]ethanol (PubChem CID 170445431) has the molecular formula C13H23N3O4S
and a molecular weight of 317.41 g/mol. Its IUPAC name is 2-[4,5-dimethyl-3-(1-methylsulfonylpiperidin-4-yl)oxypyrazol-1-yl]ethanol.
Molecular Properties
| Compound Name | 2-[4,5-dimethyl-3-(1-methylsulfonylpiperidin-4-yl)oxypyrazol-1-yl]ethanol |
| PubChem CID | 170445431 |
| Molecular Formula | C13H23N3O4S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 2-[4,5-dimethyl-3-(1-methylsulfonylpiperidin-4-yl)oxypyrazol-1-yl]ethanol |
| SMILES | Cc1c(OC2CCN(S(C)(=O)=O)CC2)nn(CCO)c1C |
| InChI | InChI=1S/C13H23N3O4S/c1-10-11(2)16(8-9-17)14-13(10)20-12-4-6-15(7-5-12)21(3,18)19/h12,17H,4-9H2,1-3H3 |
| InChIKey | RCQAITSHYNCOSI-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[4,5-dimethyl-3-(1-methylsulfonylpiperidin-4-yl)oxypyrazol-1-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4,5-dimethyl-3-(1-methylsulfonylpiperidin-4-yl)oxypyrazol-1-yl]ethanol?
The IUPAC name of 2-[4,5-dimethyl-3-(1-methylsulfonylpiperidin-4-yl)oxypyrazol-1-yl]ethanol (CID 170445431) is 2-[4,5-dimethyl-3-(1-methylsulfonylpiperidin-4-yl)oxypyrazol-1-yl]ethanol.
What is the SMILES notation for 2-[4,5-dimethyl-3-(1-methylsulfonylpiperidin-4-yl)oxypyrazol-1-yl]ethanol?
The canonical SMILES for 2-[4,5-dimethyl-3-(1-methylsulfonylpiperidin-4-yl)oxypyrazol-1-yl]ethanol is Cc1c(OC2CCN(S(C)(=O)=O)CC2)nn(CCO)c1C.
What is the InChIKey of 2-[4,5-dimethyl-3-(1-methylsulfonylpiperidin-4-yl)oxypyrazol-1-yl]ethanol?
The InChIKey is RCQAITSHYNCOSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N3O4S/c1-10-11(2)16(8-9-17)14-13(10)20-12-4-6-15(7-5-12)21(3,18)19/h12,17H,4-9H2,1-3H3.
What are the key properties of 2-[4,5-dimethyl-3-(1-methylsulfonylpiperidin-4-yl)oxypyrazol-1-yl]ethanol?
2-[4,5-dimethyl-3-(1-methylsulfonylpiperidin-4-yl)oxypyrazol-1-yl]ethanol has a molecular weight of 317.41 g/mol, XLogP of 0.30, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4,5-dimethyl-3-(1-methylsulfonylpiperidin-4-yl)oxypyrazol-1-yl]ethanol is sourced from PubChem (CID 170445431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).