About 1-chloro-2,4-dimethyl-1,2,4-triazolidine-3,5-dione
1-chloro-2,4-dimethyl-1,2,4-triazolidine-3,5-dione (PubChem CID 170447600) has the molecular formula C4H6ClN3O2
and a molecular weight of 163.56 g/mol. Its IUPAC name is 1-chloro-2,4-dimethyl-1,2,4-triazolidine-3,5-dione.
Analyze 1-chloro-2,4-dimethyl-1,2,4-triazolidine-3,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-2,4-dimethyl-1,2,4-triazolidine-3,5-dione?
The IUPAC name of 1-chloro-2,4-dimethyl-1,2,4-triazolidine-3,5-dione (CID 170447600) is 1-chloro-2,4-dimethyl-1,2,4-triazolidine-3,5-dione.
What is the SMILES notation for 1-chloro-2,4-dimethyl-1,2,4-triazolidine-3,5-dione?
The canonical SMILES for 1-chloro-2,4-dimethyl-1,2,4-triazolidine-3,5-dione is Cn1c(=O)n(C)n(Cl)c1=O.
What is the InChIKey of 1-chloro-2,4-dimethyl-1,2,4-triazolidine-3,5-dione?
The InChIKey is JZWXUGUSNIRIQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6ClN3O2/c1-6-3(9)7(2)8(5)4(6)10/h1-2H3.
What are the key properties of 1-chloro-2,4-dimethyl-1,2,4-triazolidine-3,5-dione?
1-chloro-2,4-dimethyl-1,2,4-triazolidine-3,5-dione has a molecular weight of 163.56 g/mol, XLogP of -1.11, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-2,4-dimethyl-1,2,4-triazolidine-3,5-dione is sourced from PubChem (CID 170447600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).