C7H9N3O3 — CID 170447672
5-amino-1-prop-2-enyl-1,3-diazinane-2,4,6-trione (PubChem CID 170447672) has the molecular formula C7H9N3O3 and a molecular weight of 183.17 g/mol. Its IUPAC name is 5-amino-1-prop-2-enyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-amino-1-prop-2-enyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 170447672 |
| Molecular Formula | C7H9N3O3 |
| Molecular Weight | 183.17 g/mol |
| Exact Mass | 183.06 |
| IUPAC Name | 5-amino-1-prop-2-enyl-1,3-diazinane-2,4,6-trione |
| SMILES | C=CCN1C(=O)NC(=O)C(N)C1=O |
| InChI | InChI=1S/C7H9N3O3/c1-2-3-10-6(12)4(8)5(11)9-7(10)13/h2,4H,1,3,8H2,(H,9,11,13) |
| InChIKey | JYSHHNAROLRVDP-UHFFFAOYSA-N |
| XLogP | -1.42 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.17 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|