C26H22FN5O — CID 170448333
4-(3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)-7-(8-ethynylnaphthalen-1-yl)-8-fluoro-2-methoxypyrido[4,3-d]pyrimidine (PubChem CID 170448333) has the molecular formula C26H22FN5O and a molecular weight of 439.49 g/mol. Its IUPAC name is 4-(3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)-7-(8-ethynylnaphthalen-1-yl)-8-fluoro-2-methoxypyrido[4,3-d]pyrimidine.
| Compound Name | 4-(3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)-7-(8-ethynylnaphthalen-1-yl)-8-fluoro-2-methoxypyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 170448333 |
| Molecular Formula | C26H22FN5O |
| Molecular Weight | 439.49 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | 4-(3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)-7-(8-ethynylnaphthalen-1-yl)-8-fluoro-2-methoxypyrido[4,3-d]pyrimidine |
| SMILES | C#Cc1cccc2cccc(-c3ncc4c(N5CCC6CNCC65)nc(OC)nc4c3F)c12 |
| InChI | InChI=1S/C26H22FN5O/c1-3-15-6-4-7-16-8-5-9-18(21(15)16)23-22(27)24-19(13-29-23)25(31-26(30-24)33-2)32-11-10-17-12-28-14-20(17)32/h1,4-9,13,17,20,28H,10-12,14H2,2H3 |
| InChIKey | ZUNUDZGAFAJJCD-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.49 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|