C34H26F2N6O2 — CID 170449452
(Z)-1-[1-[7-(8-ethynylnaphthalen-1-yl)-8-fluoro-2-methoxypyrido[4,3-d]pyrimidin-4-yl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]-2-fluoro-3-pyridin-2-ylprop-2-en-1-one (PubChem CID 170449452) has the molecular formula C34H26F2N6O2 and a molecular weight of 588.62 g/mol. Its IUPAC name is (Z)-1-[1-[7-(8-ethynylnaphthalen-1-yl)-8-fluoro-2-methoxypyrido[4,3-d]pyrimidin-4-yl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]-2-fluoro-3-pyridin-2-ylprop-2-en-1-one.
| Compound Name | (Z)-1-[1-[7-(8-ethynylnaphthalen-1-yl)-8-fluoro-2-methoxypyrido[4,3-d]pyrimidin-4-yl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]-2-fluoro-3-pyridin-2-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 170449452 |
| Molecular Formula | C34H26F2N6O2 |
| Molecular Weight | 588.62 g/mol |
| Exact Mass | 588.21 |
| IUPAC Name | (Z)-1-[1-[7-(8-ethynylnaphthalen-1-yl)-8-fluoro-2-methoxypyrido[4,3-d]pyrimidin-4-yl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]-2-fluoro-3-pyridin-2-ylprop-2-en-1-one |
| SMILES | C#Cc1cccc2cccc(-c3ncc4c(N5CCC6CN(C(=O)/C(F)=C/c7ccccn7)CC65)nc(OC)nc4c3F)c12 |
| InChI | InChI=1S/C34H26F2N6O2/c1-3-20-8-6-9-21-10-7-12-24(28(20)21)30-29(36)31-25(17-38-30)32(40-34(39-31)44-2)42-15-13-22-18-41(19-27(22)42)33(43)26(35)16-23-11-4-5-14-37-23/h1,4-12,14,16-17,22,27H,13,15,18-19H2,2H3/b26-16- |
| InChIKey | DVQYGDLOPPEFFJ-QQXSKIMKSA-N |
| XLogP | 5.42 |
| TPSA | 84.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.62 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|