C8H13F3N2 — CID 170450441
(3aR,6aR)-2-methyl-5-(trifluoromethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole (PubChem CID 170450441) has the molecular formula C8H13F3N2 and a molecular weight of 194.20 g/mol. Its IUPAC name is (3aR,6aR)-2-methyl-5-(trifluoromethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole.
| Compound Name | (3aR,6aR)-2-methyl-5-(trifluoromethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 170450441 |
| Molecular Formula | C8H13F3N2 |
| Molecular Weight | 194.20 g/mol |
| Exact Mass | 194.10 |
| IUPAC Name | (3aR,6aR)-2-methyl-5-(trifluoromethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
| SMILES | CN1C[C@@H]2CN(C(F)(F)F)C[C@H]2C1 |
| InChI | InChI=1S/C8H13F3N2/c1-12-2-6-4-13(8(9,10)11)5-7(6)3-12/h6-7H,2-5H2,1H3/t6-,7-/m1/s1 |
| InChIKey | VVQQASIWKYNSTQ-RNFRBKRXSA-N |
| XLogP | 1.00 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.20 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|