C9H7ClF3N3 — CID 170450705
7-chloro-N-(2,2,2-trifluoroethyl)-1H-pyrrolo[2,3-c]pyridin-4-amine (PubChem CID 170450705) has the molecular formula C9H7ClF3N3 and a molecular weight of 249.62 g/mol. Its IUPAC name is 7-chloro-N-(2,2,2-trifluoroethyl)-1H-pyrrolo[2,3-c]pyridin-4-amine.
| Compound Name | 7-chloro-N-(2,2,2-trifluoroethyl)-1H-pyrrolo[2,3-c]pyridin-4-amine |
|---|---|
| PubChem CID | 170450705 |
| Molecular Formula | C9H7ClF3N3 |
| Molecular Weight | 249.62 g/mol |
| Exact Mass | 249.03 |
| IUPAC Name | 7-chloro-N-(2,2,2-trifluoroethyl)-1H-pyrrolo[2,3-c]pyridin-4-amine |
| SMILES | FC(F)(F)CNc1cnc(Cl)c2[nH]ccc12 |
| InChI | InChI=1S/C9H7ClF3N3/c10-8-7-5(1-2-14-7)6(3-15-8)16-4-9(11,12)13/h1-3,14,16H,4H2 |
| InChIKey | BOLKAXDVIRRGDS-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.62 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|