C35H38N6 — CID 170451784
3-[4-(3,5-dimethylpyrazin-2-yl)phenyl]-5-[(7S)-7-methyl-7-[(2R)-2-methylpyrrolidin-1-yl]-5,6,8,9-tetrahydrobenzo[7]annulen-3-yl]-2H-pyrazolo[3,4-b]pyridine (PubChem CID 170451784) has the molecular formula C35H38N6 and a molecular weight of 542.73 g/mol. Its IUPAC name is 3-[4-(3,5-dimethylpyrazin-2-yl)phenyl]-5-[(7S)-7-methyl-7-[(2R)-2-methylpyrrolidin-1-yl]-5,6,8,9-tetrahydrobenzo[7]annulen-3-yl]-2H-pyrazolo[3,4-b]pyridine.
| Compound Name | 3-[4-(3,5-dimethylpyrazin-2-yl)phenyl]-5-[(7S)-7-methyl-7-[(2R)-2-methylpyrrolidin-1-yl]-5,6,8,9-tetrahydrobenzo[7]annulen-3-yl]-2H-pyrazolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 170451784 |
| Molecular Formula | C35H38N6 |
| Molecular Weight | 542.73 g/mol |
| Exact Mass | 542.32 |
| IUPAC Name | 3-[4-(3,5-dimethylpyrazin-2-yl)phenyl]-5-[(7S)-7-methyl-7-[(2R)-2-methylpyrrolidin-1-yl]-5,6,8,9-tetrahydrobenzo[7]annulen-3-yl]-2H-pyrazolo[3,4-b]pyridine |
| SMILES | Cc1cnc(-c2ccc(-c3[nH]nc4ncc(-c5ccc6c(c5)CC[C@@](C)(N5CCC[C@H]5C)CC6)cc34)cc2)c(C)n1 |
| InChI | InChI=1S/C35H38N6/c1-22-20-36-32(24(3)38-22)26-8-10-27(11-9-26)33-31-19-30(21-37-34(31)40-39-33)28-12-7-25-13-15-35(4,16-14-29(25)18-28)41-17-5-6-23(41)2/h7-12,18-21,23H,5-6,13-17H2,1-4H3,(H,37,39,40)/t23-,35+/m1/s1 |
| InChIKey | PPEKJTWDGZXDJY-LUWBXXKHSA-N |
| XLogP | 7.49 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.73 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |