C25H34N6 — CID 170452578
2-N-[3-(dimethylamino)propyl]-6-phenyl-4-N-(piperidin-4-ylmethyl)quinazoline-2,4-diamine (PubChem CID 170452578) has the molecular formula C25H34N6 and a molecular weight of 418.59 g/mol. Its IUPAC name is 2-N-[3-(dimethylamino)propyl]-6-phenyl-4-N-(piperidin-4-ylmethyl)quinazoline-2,4-diamine.
| Compound Name | 2-N-[3-(dimethylamino)propyl]-6-phenyl-4-N-(piperidin-4-ylmethyl)quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 170452578 |
| Molecular Formula | C25H34N6 |
| Molecular Weight | 418.59 g/mol |
| Exact Mass | 418.28 |
| IUPAC Name | 2-N-[3-(dimethylamino)propyl]-6-phenyl-4-N-(piperidin-4-ylmethyl)quinazoline-2,4-diamine |
| SMILES | CN(C)CCCNc1nc(NCC2CCNCC2)c2cc(-c3ccccc3)ccc2n1 |
| InChI | InChI=1S/C25H34N6/c1-31(2)16-6-13-27-25-29-23-10-9-21(20-7-4-3-5-8-20)17-22(23)24(30-25)28-18-19-11-14-26-15-12-19/h3-5,7-10,17,19,26H,6,11-16,18H2,1-2H3,(H2,27,28,29,30) |
| InChIKey | ZQESDCZQQXAWMA-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 65.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.59 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|