C9H17NO4S — CID 170452583
(2S)-1,1-dioxo-4-(oxolan-2-ylmethyl)-1,4-thiazinan-2-ol (PubChem CID 170452583) has the molecular formula C9H17NO4S and a molecular weight of 235.30 g/mol. Its IUPAC name is (2S)-1,1-dioxo-4-(oxolan-2-ylmethyl)-1,4-thiazinan-2-ol.
| Compound Name | (2S)-1,1-dioxo-4-(oxolan-2-ylmethyl)-1,4-thiazinan-2-ol |
|---|---|
| PubChem CID | 170452583 |
| Molecular Formula | C9H17NO4S |
| Molecular Weight | 235.30 g/mol |
| Exact Mass | 235.09 |
| IUPAC Name | (2S)-1,1-dioxo-4-(oxolan-2-ylmethyl)-1,4-thiazinan-2-ol |
| SMILES | O=S1(=O)CCN(CC2CCCO2)C[C@H]1O |
| InChI | InChI=1S/C9H17NO4S/c11-9-7-10(3-5-15(9,12)13)6-8-2-1-4-14-8/h8-9,11H,1-7H2/t8?,9-/m0/s1 |
| InChIKey | BXKKQRFSZARPRL-GKAPJAKFSA-N |
| XLogP | -0.79 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.30 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |