C31H30N6O3 — CID 170452597
(3R)-2-[(2R)-2-(1H-indazole-5-carbonylamino)-3-(3-methylphenyl)propanoyl]-N-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxamide (PubChem CID 170452597) has the molecular formula C31H30N6O3 and a molecular weight of 534.62 g/mol. Its IUPAC name is (3R)-2-[(2R)-2-(1H-indazole-5-carbonylamino)-3-(3-methylphenyl)propanoyl]-N-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxamide.
| Compound Name | (3R)-2-[(2R)-2-(1H-indazole-5-carbonylamino)-3-(3-methylphenyl)propanoyl]-N-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxamide |
|---|---|
| PubChem CID | 170452597 |
| Molecular Formula | C31H30N6O3 |
| Molecular Weight | 534.62 g/mol |
| Exact Mass | 534.24 |
| IUPAC Name | (3R)-2-[(2R)-2-(1H-indazole-5-carbonylamino)-3-(3-methylphenyl)propanoyl]-N-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxamide |
| SMILES | CNC(=O)[C@H]1Cc2c([nH]c3ccccc23)CN1C(=O)[C@@H](Cc1cccc(C)c1)NC(=O)c1ccc2[nH]ncc2c1 |
| InChI | InChI=1S/C31H30N6O3/c1-18-6-5-7-19(12-18)13-26(35-29(38)20-10-11-24-21(14-20)16-33-36-24)31(40)37-17-27-23(15-28(37)30(39)32-2)22-8-3-4-9-25(22)34-27/h3-12,14,16,26,28,34H,13,15,17H2,1-2H3,(H,32,39)(H,33,36)(H,35,38)/t26-,28-/m1/s1 |
| InChIKey | WOUFYINLHLQZCW-IXCJQBJRSA-N |
| XLogP | 3.39 |
| TPSA | 122.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.62 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|