C22H27N3O11S — CID 170454349
(2S,5R,6R)-6-[[(2R)-2-amino-2-[4-(6-carboxy-3,4,5-trihydroxyoxan-2-yl)oxyphenyl]acetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 170454349) has the molecular formula C22H27N3O11S and a molecular weight of 541.54 g/mol. Its IUPAC name is (2S,5R,6R)-6-[[(2R)-2-amino-2-[4-(6-carboxy-3,4,5-trihydroxyoxan-2-yl)oxyphenyl]acetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2S,5R,6R)-6-[[(2R)-2-amino-2-[4-(6-carboxy-3,4,5-trihydroxyoxan-2-yl)oxyphenyl]acetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 170454349 |
| Molecular Formula | C22H27N3O11S |
| Molecular Weight | 541.54 g/mol |
| Exact Mass | 541.14 |
| IUPAC Name | (2S,5R,6R)-6-[[(2R)-2-amino-2-[4-(6-carboxy-3,4,5-trihydroxyoxan-2-yl)oxyphenyl]acetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | CC1(C)S[C@@H]2[C@H](NC(=O)[C@H](N)c3ccc(OC4OC(C(=O)O)C(O)C(O)C4O)cc3)C(=O)N2[C@H]1C(=O)O |
| InChI | InChI=1S/C22H27N3O11S/c1-22(2)15(20(33)34)25-17(30)10(18(25)37-22)24-16(29)9(23)7-3-5-8(6-4-7)35-21-13(28)11(26)12(27)14(36-21)19(31)32/h3-6,9-15,18,21,26-28H,23H2,1-2H3,(H,24,29)(H,31,32)(H,33,34)/t9-,10-,11?,12?,13?,14?,15+,18-,21?/m1/s1 |
| InChIKey | COKPHHPOOMWYSM-DVYLSOGJSA-N |
| XLogP | -2.41 |
| TPSA | 229.18 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.54 |
| LogP ≤ 5 | -2.41 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |