C10H12N2O5S — CID 170454853
(2S,5R,6R)-3,3-dimethyl-6-(oxaldehydoylamino)-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 170454853) has the molecular formula C10H12N2O5S and a molecular weight of 272.28 g/mol. Its IUPAC name is (2S,5R,6R)-3,3-dimethyl-6-(oxaldehydoylamino)-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2S,5R,6R)-3,3-dimethyl-6-(oxaldehydoylamino)-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 170454853 |
| Molecular Formula | C10H12N2O5S |
| Molecular Weight | 272.28 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | (2S,5R,6R)-3,3-dimethyl-6-(oxaldehydoylamino)-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | CC1(C)S[C@@H]2[C@H](NC(=O)C=O)C(=O)N2[C@H]1C(=O)O |
| InChI | InChI=1S/C10H12N2O5S/c1-10(2)6(9(16)17)12-7(15)5(8(12)18-10)11-4(14)3-13/h3,5-6,8H,1-2H3,(H,11,14)(H,16,17)/t5-,6+,8-/m1/s1 |
| InChIKey | IZGDDZCBZBJXID-GKROBHDKSA-N |
| XLogP | -1.18 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.28 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|