C18H33ClN2O6S — CID 170455057
(2S,4R)-N-[(1S,2S)-2-chloro-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-4-(3-hydroxypropyl)-1-methylpyrrolidine-2-carboxamide (PubChem CID 170455057) has the molecular formula C18H33ClN2O6S and a molecular weight of 440.99 g/mol. Its IUPAC name is (2S,4R)-N-[(1S,2S)-2-chloro-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-4-(3-hydroxypropyl)-1-methylpyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-N-[(1S,2S)-2-chloro-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-4-(3-hydroxypropyl)-1-methylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 170455057 |
| Molecular Formula | C18H33ClN2O6S |
| Molecular Weight | 440.99 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | (2S,4R)-N-[(1S,2S)-2-chloro-1-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methylsulfanyloxan-2-yl]propyl]-4-(3-hydroxypropyl)-1-methylpyrrolidine-2-carboxamide |
| SMILES | CS[C@H]1O[C@H]([C@H](NC(=O)[C@@H]2C[C@@H](CCCO)CN2C)[C@H](C)Cl)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C18H33ClN2O6S/c1-9(19)12(16-14(24)13(23)15(25)18(27-16)28-3)20-17(26)11-7-10(5-4-6-22)8-21(11)2/h9-16,18,22-25H,4-8H2,1-3H3,(H,20,26)/t9-,10+,11-,12+,13-,14+,15+,16+,18+/m0/s1 |
| InChIKey | LAURAGLBKNNJCX-AWPVFWJPSA-N |
| XLogP | -0.64 |
| TPSA | 122.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.99 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|