About 1-ethyl-7-fluoro-5-oxo-8-piperazin-1-ylpyrido[2,3-e][1,4]oxazepine-3-carboxylic acid
1-ethyl-7-fluoro-5-oxo-8-piperazin-1-ylpyrido[2,3-e][1,4]oxazepine-3-carboxylic acid (PubChem CID 170455347) has the molecular formula C15H17FN4O4
and a molecular weight of 336.32 g/mol. Its IUPAC name is 1-ethyl-7-fluoro-5-oxo-8-piperazin-1-ylpyrido[2,3-e][1,4]oxazepine-3-carboxylic acid.
Molecular Properties
| Compound Name | 1-ethyl-7-fluoro-5-oxo-8-piperazin-1-ylpyrido[2,3-e][1,4]oxazepine-3-carboxylic acid |
| PubChem CID | 170455347 |
| Molecular Formula | C15H17FN4O4 |
| Molecular Weight | 336.32 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 1-ethyl-7-fluoro-5-oxo-8-piperazin-1-ylpyrido[2,3-e][1,4]oxazepine-3-carboxylic acid |
| SMILES | CCN1C=C(C(=O)O)OC(=O)c2cc(F)c(N3CCNCC3)nc21 |
| InChI | InChI=1S/C15H17FN4O4/c1-2-19-8-11(14(21)22)24-15(23)9-7-10(16)13(18-12(9)19)20-5-3-17-4-6-20/h7-8,17H,2-6H2,1H3,(H,21,22) |
| InChIKey | OFCRFHGNDCZSAQ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 95.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.32 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-ethyl-7-fluoro-5-oxo-8-piperazin-1-ylpyrido[2,3-e][1,4]oxazepine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-7-fluoro-5-oxo-8-piperazin-1-ylpyrido[2,3-e][1,4]oxazepine-3-carboxylic acid?
The IUPAC name of 1-ethyl-7-fluoro-5-oxo-8-piperazin-1-ylpyrido[2,3-e][1,4]oxazepine-3-carboxylic acid (CID 170455347) is 1-ethyl-7-fluoro-5-oxo-8-piperazin-1-ylpyrido[2,3-e][1,4]oxazepine-3-carboxylic acid.
What is the SMILES notation for 1-ethyl-7-fluoro-5-oxo-8-piperazin-1-ylpyrido[2,3-e][1,4]oxazepine-3-carboxylic acid?
The canonical SMILES for 1-ethyl-7-fluoro-5-oxo-8-piperazin-1-ylpyrido[2,3-e][1,4]oxazepine-3-carboxylic acid is CCN1C=C(C(=O)O)OC(=O)c2cc(F)c(N3CCNCC3)nc21.
What is the InChIKey of 1-ethyl-7-fluoro-5-oxo-8-piperazin-1-ylpyrido[2,3-e][1,4]oxazepine-3-carboxylic acid?
The InChIKey is OFCRFHGNDCZSAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17FN4O4/c1-2-19-8-11(14(21)22)24-15(23)9-7-10(16)13(18-12(9)19)20-5-3-17-4-6-20/h7-8,17H,2-6H2,1H3,(H,21,22).
What are the key properties of 1-ethyl-7-fluoro-5-oxo-8-piperazin-1-ylpyrido[2,3-e][1,4]oxazepine-3-carboxylic acid?
1-ethyl-7-fluoro-5-oxo-8-piperazin-1-ylpyrido[2,3-e][1,4]oxazepine-3-carboxylic acid has a molecular weight of 336.32 g/mol, XLogP of 0.55, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-7-fluoro-5-oxo-8-piperazin-1-ylpyrido[2,3-e][1,4]oxazepine-3-carboxylic acid is sourced from PubChem (CID 170455347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).