About (2S)-2-[2-[[(2S)-1-hydroxybutan-2-yl]amino]ethylamino]butane-1,4-diol
(2S)-2-[2-[[(2S)-1-hydroxybutan-2-yl]amino]ethylamino]butane-1,4-diol (PubChem CID 170456355) has the molecular formula C10H24N2O3
and a molecular weight of 220.31 g/mol. Its IUPAC name is (2S)-2-[2-[[(2S)-1-hydroxybutan-2-yl]amino]ethylamino]butane-1,4-diol.
Molecular Properties
| Compound Name | (2S)-2-[2-[[(2S)-1-hydroxybutan-2-yl]amino]ethylamino]butane-1,4-diol |
| PubChem CID | 170456355 |
| Molecular Formula | C10H24N2O3 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | (2S)-2-[2-[[(2S)-1-hydroxybutan-2-yl]amino]ethylamino]butane-1,4-diol |
| SMILES | CC[C@@H](CO)NCCN[C@H](CO)CCO |
| InChI | InChI=1S/C10H24N2O3/c1-2-9(7-14)11-4-5-12-10(8-15)3-6-13/h9-15H,2-8H2,1H3/t9-,10-/m0/s1 |
| InChIKey | ZSQAPPRHLJUBFR-UWVGGRQHSA-N |
| XLogP | -1.32 |
| TPSA | 84.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-[2-[[(2S)-1-hydroxybutan-2-yl]amino]ethylamino]butane-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[2-[[(2S)-1-hydroxybutan-2-yl]amino]ethylamino]butane-1,4-diol?
The IUPAC name of (2S)-2-[2-[[(2S)-1-hydroxybutan-2-yl]amino]ethylamino]butane-1,4-diol (CID 170456355) is (2S)-2-[2-[[(2S)-1-hydroxybutan-2-yl]amino]ethylamino]butane-1,4-diol.
What is the SMILES notation for (2S)-2-[2-[[(2S)-1-hydroxybutan-2-yl]amino]ethylamino]butane-1,4-diol?
The canonical SMILES for (2S)-2-[2-[[(2S)-1-hydroxybutan-2-yl]amino]ethylamino]butane-1,4-diol is CC[C@@H](CO)NCCN[C@H](CO)CCO.
What is the InChIKey of (2S)-2-[2-[[(2S)-1-hydroxybutan-2-yl]amino]ethylamino]butane-1,4-diol?
The InChIKey is ZSQAPPRHLJUBFR-UWVGGRQHSA-N. The full InChI is InChI=1S/C10H24N2O3/c1-2-9(7-14)11-4-5-12-10(8-15)3-6-13/h9-15H,2-8H2,1H3/t9-,10-/m0/s1.
What are the key properties of (2S)-2-[2-[[(2S)-1-hydroxybutan-2-yl]amino]ethylamino]butane-1,4-diol?
(2S)-2-[2-[[(2S)-1-hydroxybutan-2-yl]amino]ethylamino]butane-1,4-diol has a molecular weight of 220.31 g/mol, XLogP of -1.32, 10 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[2-[[(2S)-1-hydroxybutan-2-yl]amino]ethylamino]butane-1,4-diol is sourced from PubChem (CID 170456355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).