C19H27BFNO4 — CID 170456838
2-[4-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-N-(oxan-4-yl)acetamide (PubChem CID 170456838) has the molecular formula C19H27BFNO4 and a molecular weight of 363.24 g/mol. Its IUPAC name is 2-[4-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-N-(oxan-4-yl)acetamide.
| Compound Name | 2-[4-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-N-(oxan-4-yl)acetamide |
|---|---|
| PubChem CID | 170456838 |
| Molecular Formula | C19H27BFNO4 |
| Molecular Weight | 363.24 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | 2-[4-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-N-(oxan-4-yl)acetamide |
| SMILES | CC1(C)OB(c2cc(F)ccc2CC(=O)NC2CCOCC2)OC1(C)C |
| InChI | InChI=1S/C19H27BFNO4/c1-18(2)19(3,4)26-20(25-18)16-12-14(21)6-5-13(16)11-17(23)22-15-7-9-24-10-8-15/h5-6,12,15H,7-11H2,1-4H3,(H,22,23) |
| InChIKey | VPCMBXLFSKSJPZ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.24 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|