C15H21BrN2O4 — CID 170457890
tert-butyl N-[(E)-1-(3-bromo-4-hydroxy-5-methoxyphenyl)propan-2-ylideneamino]carbamate (PubChem CID 170457890) has the molecular formula C15H21BrN2O4 and a molecular weight of 373.25 g/mol. Its IUPAC name is tert-butyl N-[(E)-1-(3-bromo-4-hydroxy-5-methoxyphenyl)propan-2-ylideneamino]carbamate.
| Compound Name | tert-butyl N-[(E)-1-(3-bromo-4-hydroxy-5-methoxyphenyl)propan-2-ylideneamino]carbamate |
|---|---|
| PubChem CID | 170457890 |
| Molecular Formula | C15H21BrN2O4 |
| Molecular Weight | 373.25 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | tert-butyl N-[(E)-1-(3-bromo-4-hydroxy-5-methoxyphenyl)propan-2-ylideneamino]carbamate |
| SMILES | COc1cc(C/C(C)=N/NC(=O)OC(C)(C)C)cc(Br)c1O |
| InChI | InChI=1S/C15H21BrN2O4/c1-9(17-18-14(20)22-15(2,3)4)6-10-7-11(16)13(19)12(8-10)21-5/h7-8,19H,6H2,1-5H3,(H,18,20)/b17-9+ |
| InChIKey | KVTURVDJXWTWAW-RQZCQDPDSA-N |
| XLogP | 3.61 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.25 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|