About 1-hexyl-1,3,3-trimethylthiourea
1-hexyl-1,3,3-trimethylthiourea (PubChem CID 170458374) has the molecular formula C10H22N2S
and a molecular weight of 202.37 g/mol. Its IUPAC name is 1-hexyl-1,3,3-trimethylthiourea.
Molecular Properties
| Compound Name | 1-hexyl-1,3,3-trimethylthiourea |
| PubChem CID | 170458374 |
| Molecular Formula | C10H22N2S |
| Molecular Weight | 202.37 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 1-hexyl-1,3,3-trimethylthiourea |
| SMILES | CCCCCCN(C)C(=S)N(C)C |
| InChI | InChI=1S/C10H22N2S/c1-5-6-7-8-9-12(4)10(13)11(2)3/h5-9H2,1-4H3 |
| InChIKey | WXHFUJGWSHETCC-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.37 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-hexyl-1,3,3-trimethylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hexyl-1,3,3-trimethylthiourea?
The IUPAC name of 1-hexyl-1,3,3-trimethylthiourea (CID 170458374) is 1-hexyl-1,3,3-trimethylthiourea.
What is the SMILES notation for 1-hexyl-1,3,3-trimethylthiourea?
The canonical SMILES for 1-hexyl-1,3,3-trimethylthiourea is CCCCCCN(C)C(=S)N(C)C.
What is the InChIKey of 1-hexyl-1,3,3-trimethylthiourea?
The InChIKey is WXHFUJGWSHETCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N2S/c1-5-6-7-8-9-12(4)10(13)11(2)3/h5-9H2,1-4H3.
What are the key properties of 1-hexyl-1,3,3-trimethylthiourea?
1-hexyl-1,3,3-trimethylthiourea has a molecular weight of 202.37 g/mol, XLogP of 2.35, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hexyl-1,3,3-trimethylthiourea is sourced from PubChem (CID 170458374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).