C16H8N2 — CID 170458510
phenanthrene-1,10-dicarbonitrile (PubChem CID 170458510) has the molecular formula C16H8N2 and a molecular weight of 228.25 g/mol. Its IUPAC name is phenanthrene-1,10-dicarbonitrile.
| Compound Name | phenanthrene-1,10-dicarbonitrile |
|---|---|
| PubChem CID | 170458510 |
| Molecular Formula | C16H8N2 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | phenanthrene-1,10-dicarbonitrile |
| SMILES | N#Cc1cccc2c1c(C#N)cc1ccccc12 |
| InChI | InChI=1S/C16H8N2/c17-9-12-5-3-7-15-14-6-2-1-4-11(14)8-13(10-18)16(12)15/h1-8H |
| InChIKey | SYIRVGFQPTZGEG-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|