About (3R)-4,7-dichloro-3-hydroxy-3-sulfanyl-1H-indol-2-one
(3R)-4,7-dichloro-3-hydroxy-3-sulfanyl-1H-indol-2-one (PubChem CID 170458980) has the molecular formula C8H5Cl2NO2S
and a molecular weight of 250.11 g/mol. Its IUPAC name is (3R)-4,7-dichloro-3-hydroxy-3-sulfanyl-1H-indol-2-one.
Molecular Properties
| Compound Name | (3R)-4,7-dichloro-3-hydroxy-3-sulfanyl-1H-indol-2-one |
| PubChem CID | 170458980 |
| Molecular Formula | C8H5Cl2NO2S |
| Molecular Weight | 250.11 g/mol |
| Exact Mass | 248.94 |
| IUPAC Name | (3R)-4,7-dichloro-3-hydroxy-3-sulfanyl-1H-indol-2-one |
| SMILES | O=C1Nc2c(Cl)ccc(Cl)c2[C@@]1(O)S |
| InChI | InChI=1S/C8H5Cl2NO2S/c9-3-1-2-4(10)6-5(3)8(13,14)7(12)11-6/h1-2,13-14H,(H,11,12)/t8-/m1/s1 |
| InChIKey | NVRZVOPLLIEJFB-MRVPVSSYSA-N |
| XLogP | 2.02 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.11 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (3R)-4,7-dichloro-3-hydroxy-3-sulfanyl-1H-indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-4,7-dichloro-3-hydroxy-3-sulfanyl-1H-indol-2-one?
The IUPAC name of (3R)-4,7-dichloro-3-hydroxy-3-sulfanyl-1H-indol-2-one (CID 170458980) is (3R)-4,7-dichloro-3-hydroxy-3-sulfanyl-1H-indol-2-one.
What is the SMILES notation for (3R)-4,7-dichloro-3-hydroxy-3-sulfanyl-1H-indol-2-one?
The canonical SMILES for (3R)-4,7-dichloro-3-hydroxy-3-sulfanyl-1H-indol-2-one is O=C1Nc2c(Cl)ccc(Cl)c2[C@@]1(O)S.
What is the InChIKey of (3R)-4,7-dichloro-3-hydroxy-3-sulfanyl-1H-indol-2-one?
The InChIKey is NVRZVOPLLIEJFB-MRVPVSSYSA-N. The full InChI is InChI=1S/C8H5Cl2NO2S/c9-3-1-2-4(10)6-5(3)8(13,14)7(12)11-6/h1-2,13-14H,(H,11,12)/t8-/m1/s1.
What are the key properties of (3R)-4,7-dichloro-3-hydroxy-3-sulfanyl-1H-indol-2-one?
(3R)-4,7-dichloro-3-hydroxy-3-sulfanyl-1H-indol-2-one has a molecular weight of 250.11 g/mol, XLogP of 2.02, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-4,7-dichloro-3-hydroxy-3-sulfanyl-1H-indol-2-one is sourced from PubChem (CID 170458980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).