C28H33N3O3 — CID 170459214
2-(2,6-diethyl-4-pyridin-4-ylanilino)-6-(1,4-oxazepan-4-ylmethyl)benzoic acid (PubChem CID 170459214) has the molecular formula C28H33N3O3 and a molecular weight of 459.59 g/mol. Its IUPAC name is 2-(2,6-diethyl-4-pyridin-4-ylanilino)-6-(1,4-oxazepan-4-ylmethyl)benzoic acid.
| Compound Name | 2-(2,6-diethyl-4-pyridin-4-ylanilino)-6-(1,4-oxazepan-4-ylmethyl)benzoic acid |
|---|---|
| PubChem CID | 170459214 |
| Molecular Formula | C28H33N3O3 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.25 |
| IUPAC Name | 2-(2,6-diethyl-4-pyridin-4-ylanilino)-6-(1,4-oxazepan-4-ylmethyl)benzoic acid |
| SMILES | CCc1cc(-c2ccncc2)cc(CC)c1Nc1cccc(CN2CCCOCC2)c1C(=O)O |
| InChI | InChI=1S/C28H33N3O3/c1-3-20-17-24(22-9-11-29-12-10-22)18-21(4-2)27(20)30-25-8-5-7-23(26(25)28(32)33)19-31-13-6-15-34-16-14-31/h5,7-12,17-18,30H,3-4,6,13-16,19H2,1-2H3,(H,32,33) |
| InChIKey | DYKGFUNWMFFSJF-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |