About 1,4-Butanediol diglycidyl ether
1,4-Butanediol diglycidyl ether (PubChem CID 17046) has the molecular formula C10H18O4
and a molecular weight of 202.25 g/mol. Its IUPAC name is 2-[4-(oxiran-2-ylmethoxy)butoxymethyl]oxirane.
Molecular Properties
| Compound Name | 1,4-Butanediol diglycidyl ether |
| PubChem CID | 17046 |
| Molecular Formula | C10H18O4 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 2-[4-(oxiran-2-ylmethoxy)butoxymethyl]oxirane |
| SMILES | C1C(O1)COCCCCOCC2CO2 |
| InChI | InChI=1S/C10H18O4/c1(3-11-5-9-7-13-9)2-4-12-6-10-8-14-10/h9-10H,1-8H2 |
| InChIKey | SHKUUQIDMUMQQK-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 43.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | 144 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1,4-Butanediol diglycidyl ether with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-Butanediol diglycidyl ether?
The IUPAC name of 1,4-Butanediol diglycidyl ether (CID 17046) is 2-[4-(oxiran-2-ylmethoxy)butoxymethyl]oxirane.
What is the SMILES notation for 1,4-Butanediol diglycidyl ether?
The canonical SMILES for 1,4-Butanediol diglycidyl ether is C1C(O1)COCCCCOCC2CO2.
What is the InChIKey of 1,4-Butanediol diglycidyl ether?
The InChIKey is SHKUUQIDMUMQQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O4/c1(3-11-5-9-7-13-9)2-4-12-6-10-8-14-10/h9-10H,1-8H2.
What are the key properties of 1,4-Butanediol diglycidyl ether?
1,4-Butanediol diglycidyl ether has a molecular weight of 202.25 g/mol, XLogP of 0.00, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-Butanediol diglycidyl ether is sourced from PubChem (CID 17046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).