About 1-ethenyl-3-[(3-ethenylimidazol-1-ium-1-yl)methyl]imidazol-3-ium dihexafluorophosphate
1-ethenyl-3-[(3-ethenylimidazol-1-ium-1-yl)methyl]imidazol-3-ium dihexafluorophosphate (PubChem CID 170460029) has the molecular formula C11H14F12N4P2
and a molecular weight of 492.19 g/mol. Its IUPAC name is 1-ethenyl-3-[(3-ethenylimidazol-1-ium-1-yl)methyl]imidazol-3-ium dihexafluorophosphate.
Molecular Properties
| Compound Name | 1-ethenyl-3-[(3-ethenylimidazol-1-ium-1-yl)methyl]imidazol-3-ium dihexafluorophosphate |
| PubChem CID | 170460029 |
| Molecular Formula | C11H14F12N4P2 |
| Molecular Weight | 492.19 g/mol |
| Exact Mass | 492.05 |
| IUPAC Name | 1-ethenyl-3-[(3-ethenylimidazol-1-ium-1-yl)methyl]imidazol-3-ium dihexafluorophosphate |
| SMILES | C=Cn1cc[n+](C[n+]2ccn(C=C)c2)c1.F[P-](F)(F)(F)(F)F.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C11H14N4.2F6P/c1-3-12-5-7-14(9-12)11-15-8-6-13(4-2)10-15;2*1-7(2,3,4,5)6/h3-10H,1-2,11H2;;/q+2;2*-1 |
| InChIKey | VEHILRSYILIPSG-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 17.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 492.19 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-ethenyl-3-[(3-ethenylimidazol-1-ium-1-yl)methyl]imidazol-3-ium dihexafluorophosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenyl-3-[(3-ethenylimidazol-1-ium-1-yl)methyl]imidazol-3-ium dihexafluorophosphate?
The IUPAC name of 1-ethenyl-3-[(3-ethenylimidazol-1-ium-1-yl)methyl]imidazol-3-ium dihexafluorophosphate (CID 170460029) is 1-ethenyl-3-[(3-ethenylimidazol-1-ium-1-yl)methyl]imidazol-3-ium dihexafluorophosphate.
What is the SMILES notation for 1-ethenyl-3-[(3-ethenylimidazol-1-ium-1-yl)methyl]imidazol-3-ium dihexafluorophosphate?
The canonical SMILES for 1-ethenyl-3-[(3-ethenylimidazol-1-ium-1-yl)methyl]imidazol-3-ium dihexafluorophosphate is C=Cn1cc[n+](C[n+]2ccn(C=C)c2)c1.F[P-](F)(F)(F)(F)F.F[P-](F)(F)(F)(F)F.
What is the InChIKey of 1-ethenyl-3-[(3-ethenylimidazol-1-ium-1-yl)methyl]imidazol-3-ium dihexafluorophosphate?
The InChIKey is VEHILRSYILIPSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N4.2F6P/c1-3-12-5-7-14(9-12)11-15-8-6-13(4-2)10-15;2*1-7(2,3,4,5)6/h3-10H,1-2,11H2;;/q+2;2*-1.
What are the key properties of 1-ethenyl-3-[(3-ethenylimidazol-1-ium-1-yl)methyl]imidazol-3-ium dihexafluorophosphate?
1-ethenyl-3-[(3-ethenylimidazol-1-ium-1-yl)methyl]imidazol-3-ium dihexafluorophosphate has a molecular weight of 492.19 g/mol, XLogP of 7.34, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenyl-3-[(3-ethenylimidazol-1-ium-1-yl)methyl]imidazol-3-ium dihexafluorophosphate is sourced from PubChem (CID 170460029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).