C22H26BrN3O4S — CID 17046007
N-[[[2-(2-bromo-4-propan-2-ylphenoxy)acetyl]amino]carbamothioyl]-2-propan-2-yloxybenzamide (PubChem CID 17046007) has the molecular formula C22H26BrN3O4S and a molecular weight of 508.44 g/mol. Its IUPAC name is N-[[[2-(2-bromo-4-propan-2-ylphenoxy)acetyl]amino]carbamothioyl]-2-propan-2-yloxybenzamide.
| Compound Name | N-[[[2-(2-bromo-4-propan-2-ylphenoxy)acetyl]amino]carbamothioyl]-2-propan-2-yloxybenzamide |
|---|---|
| PubChem CID | 17046007 |
| Molecular Formula | C22H26BrN3O4S |
| Molecular Weight | 508.44 g/mol |
| Exact Mass | 507.08 |
| IUPAC Name | N-[[[2-(2-bromo-4-propan-2-ylphenoxy)acetyl]amino]carbamothioyl]-2-propan-2-yloxybenzamide |
| SMILES | CC(C)Oc1ccccc1C(=O)NC(=S)NNC(=O)COc1ccc(C(C)C)cc1Br |
| InChI | InChI=1S/C22H26BrN3O4S/c1-13(2)15-9-10-19(17(23)11-15)29-12-20(27)25-26-22(31)24-21(28)16-7-5-6-8-18(16)30-14(3)4/h5-11,13-14H,12H2,1-4H3,(H,25,27)(H2,24,26,28,31) |
| InChIKey | PPTYUCXVNNDYOY-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.44 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|