C26H20N2O2 — CID 170460450
9H-fluoren-9-ylmethyl N-[4-(3-cyanophenyl)but-3-ynyl]carbamate (PubChem CID 170460450) has the molecular formula C26H20N2O2 and a molecular weight of 392.46 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[4-(3-cyanophenyl)but-3-ynyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[4-(3-cyanophenyl)but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 170460450 |
| Molecular Formula | C26H20N2O2 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[4-(3-cyanophenyl)but-3-ynyl]carbamate |
| SMILES | N#Cc1cccc(C#CCCNC(=O)OCC2c3ccccc3-c3ccccc32)c1 |
| InChI | InChI=1S/C26H20N2O2/c27-17-20-10-7-9-19(16-20)8-5-6-15-28-26(29)30-18-25-23-13-3-1-11-21(23)22-12-2-4-14-24(22)25/h1-4,7,9-14,16,25H,6,15,18H2,(H,28,29) |
| InChIKey | YCWDJAZCEOFMEL-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|