C27H22FNO4 — CID 170461280
methyl 4-[4-(9H-fluoren-9-ylmethoxycarbonylamino)but-1-ynyl]-2-fluorobenzoate (PubChem CID 170461280) has the molecular formula C27H22FNO4 and a molecular weight of 443.47 g/mol. Its IUPAC name is methyl 4-[4-(9H-fluoren-9-ylmethoxycarbonylamino)but-1-ynyl]-2-fluorobenzoate.
| Compound Name | methyl 4-[4-(9H-fluoren-9-ylmethoxycarbonylamino)but-1-ynyl]-2-fluorobenzoate |
|---|---|
| PubChem CID | 170461280 |
| Molecular Formula | C27H22FNO4 |
| Molecular Weight | 443.47 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | methyl 4-[4-(9H-fluoren-9-ylmethoxycarbonylamino)but-1-ynyl]-2-fluorobenzoate |
| SMILES | COC(=O)c1ccc(C#CCCNC(=O)OCC2c3ccccc3-c3ccccc32)cc1F |
| InChI | InChI=1S/C27H22FNO4/c1-32-26(30)23-14-13-18(16-25(23)28)8-6-7-15-29-27(31)33-17-24-21-11-4-2-9-19(21)20-10-3-5-12-22(20)24/h2-5,9-14,16,24H,7,15,17H2,1H3,(H,29,31) |
| InChIKey | GZOXJXUROLTAOE-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.47 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|