C9H11N3O2 — CID 170463978
4-hydroxy-5-[4-(methylamino)but-1-ynyl]-1H-pyrimidin-6-one (PubChem CID 170463978) has the molecular formula C9H11N3O2 and a molecular weight of 193.21 g/mol. Its IUPAC name is 4-hydroxy-5-[4-(methylamino)but-1-ynyl]-1H-pyrimidin-6-one.
| Compound Name | 4-hydroxy-5-[4-(methylamino)but-1-ynyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 170463978 |
| Molecular Formula | C9H11N3O2 |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 4-hydroxy-5-[4-(methylamino)but-1-ynyl]-1H-pyrimidin-6-one |
| SMILES | CNCCC#Cc1c(O)nc[nH]c1=O |
| InChI | InChI=1S/C9H11N3O2/c1-10-5-3-2-4-7-8(13)11-6-12-9(7)14/h6,10H,3,5H2,1H3,(H2,11,12,13,14) |
| InChIKey | UGBKTIUJMJFIRI-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|