C9H6BrCl2N — CID 170465817
3-(4-bromobut-1-ynyl)-2,5-dichloropyridine (PubChem CID 170465817) has the molecular formula C9H6BrCl2N and a molecular weight of 278.96 g/mol. Its IUPAC name is 3-(4-bromobut-1-ynyl)-2,5-dichloropyridine.
| Compound Name | 3-(4-bromobut-1-ynyl)-2,5-dichloropyridine |
|---|---|
| PubChem CID | 170465817 |
| Molecular Formula | C9H6BrCl2N |
| Molecular Weight | 278.96 g/mol |
| Exact Mass | 276.91 |
| IUPAC Name | 3-(4-bromobut-1-ynyl)-2,5-dichloropyridine |
| SMILES | Clc1cnc(Cl)c(C#CCCBr)c1 |
| InChI | InChI=1S/C9H6BrCl2N/c10-4-2-1-3-7-5-8(11)6-13-9(7)12/h5-6H,2,4H2 |
| InChIKey | WISKYMFRWMBTGA-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.96 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|