C12H11N3O2 — CID 170471411
ethyl 4-(1H-pyrazolo[4,5-b]pyridin-6-yl)but-3-ynoate (PubChem CID 170471411) has the molecular formula C12H11N3O2 and a molecular weight of 229.24 g/mol. Its IUPAC name is ethyl 4-(1H-pyrazolo[4,5-b]pyridin-6-yl)but-3-ynoate.
| Compound Name | ethyl 4-(1H-pyrazolo[4,5-b]pyridin-6-yl)but-3-ynoate |
|---|---|
| PubChem CID | 170471411 |
| Molecular Formula | C12H11N3O2 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | ethyl 4-(1H-pyrazolo[4,5-b]pyridin-6-yl)but-3-ynoate |
| SMILES | CCOC(=O)CC#Cc1cnc2cn[nH]c2c1 |
| InChI | InChI=1S/C12H11N3O2/c1-2-17-12(16)5-3-4-9-6-10-11(13-7-9)8-14-15-10/h6-8H,2,5H2,1H3,(H,14,15) |
| InChIKey | GFJOBUYJPKZTOF-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|