C12H12N2O4 — CID 170471610
6-amino-5-(4-ethoxy-4-oxobut-1-ynyl)pyridine-3-carboxylic acid (PubChem CID 170471610) has the molecular formula C12H12N2O4 and a molecular weight of 248.24 g/mol. Its IUPAC name is 6-amino-5-(4-ethoxy-4-oxobut-1-ynyl)pyridine-3-carboxylic acid.
| Compound Name | 6-amino-5-(4-ethoxy-4-oxobut-1-ynyl)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 170471610 |
| Molecular Formula | C12H12N2O4 |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 6-amino-5-(4-ethoxy-4-oxobut-1-ynyl)pyridine-3-carboxylic acid |
| SMILES | CCOC(=O)CC#Cc1cc(C(=O)O)cnc1N |
| InChI | InChI=1S/C12H12N2O4/c1-2-18-10(15)5-3-4-8-6-9(12(16)17)7-14-11(8)13/h6-7H,2,5H2,1H3,(H2,13,14)(H,16,17) |
| InChIKey | RTHXRRIOFYYKNA-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 102.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|