About 4-(2-amino-4-methyl-1,3-thiazol-5-yl)but-3-ynamide
4-(2-amino-4-methyl-1,3-thiazol-5-yl)but-3-ynamide (PubChem CID 170472466) has the molecular formula C8H9N3OS
and a molecular weight of 195.25 g/mol. Its IUPAC name is 4-(2-amino-4-methyl-1,3-thiazol-5-yl)but-3-ynamide.
Molecular Properties
| Compound Name | 4-(2-amino-4-methyl-1,3-thiazol-5-yl)but-3-ynamide |
| PubChem CID | 170472466 |
| Molecular Formula | C8H9N3OS |
| Molecular Weight | 195.25 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | 4-(2-amino-4-methyl-1,3-thiazol-5-yl)but-3-ynamide |
| SMILES | Cc1nc(N)sc1C#CCC(N)=O |
| InChI | InChI=1S/C8H9N3OS/c1-5-6(13-8(10)11-5)3-2-4-7(9)12/h4H2,1H3,(H2,9,12)(H2,10,11) |
| InChIKey | UZDUNEAPTFQDRN-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.25 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-amino-4-methyl-1,3-thiazol-5-yl)but-3-ynamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-amino-4-methyl-1,3-thiazol-5-yl)but-3-ynamide?
The IUPAC name of 4-(2-amino-4-methyl-1,3-thiazol-5-yl)but-3-ynamide (CID 170472466) is 4-(2-amino-4-methyl-1,3-thiazol-5-yl)but-3-ynamide.
What is the SMILES notation for 4-(2-amino-4-methyl-1,3-thiazol-5-yl)but-3-ynamide?
The canonical SMILES for 4-(2-amino-4-methyl-1,3-thiazol-5-yl)but-3-ynamide is Cc1nc(N)sc1C#CCC(N)=O.
What is the InChIKey of 4-(2-amino-4-methyl-1,3-thiazol-5-yl)but-3-ynamide?
The InChIKey is UZDUNEAPTFQDRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3OS/c1-5-6(13-8(10)11-5)3-2-4-7(9)12/h4H2,1H3,(H2,9,12)(H2,10,11).
What are the key properties of 4-(2-amino-4-methyl-1,3-thiazol-5-yl)but-3-ynamide?
4-(2-amino-4-methyl-1,3-thiazol-5-yl)but-3-ynamide has a molecular weight of 195.25 g/mol, XLogP of 0.26, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-amino-4-methyl-1,3-thiazol-5-yl)but-3-ynamide is sourced from PubChem (CID 170472466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).