About 4-(2-amino-1,3-benzothiazol-4-yl)but-3-ynenitrile
4-(2-amino-1,3-benzothiazol-4-yl)but-3-ynenitrile (PubChem CID 170474983) has the molecular formula C11H7N3S
and a molecular weight of 213.26 g/mol. Its IUPAC name is 4-(2-amino-1,3-benzothiazol-4-yl)but-3-ynenitrile.
Molecular Properties
| Compound Name | 4-(2-amino-1,3-benzothiazol-4-yl)but-3-ynenitrile |
| PubChem CID | 170474983 |
| Molecular Formula | C11H7N3S |
| Molecular Weight | 213.26 g/mol |
| Exact Mass | 213.04 |
| IUPAC Name | 4-(2-amino-1,3-benzothiazol-4-yl)but-3-ynenitrile |
| SMILES | N#CCC#Cc1cccc2sc(N)nc12 |
| InChI | InChI=1S/C11H7N3S/c12-7-2-1-4-8-5-3-6-9-10(8)14-11(13)15-9/h3,5-6H,2H2,(H2,13,14) |
| InChIKey | QAEKMJKLBXOYJJ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.26 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-amino-1,3-benzothiazol-4-yl)but-3-ynenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-amino-1,3-benzothiazol-4-yl)but-3-ynenitrile?
The IUPAC name of 4-(2-amino-1,3-benzothiazol-4-yl)but-3-ynenitrile (CID 170474983) is 4-(2-amino-1,3-benzothiazol-4-yl)but-3-ynenitrile.
What is the SMILES notation for 4-(2-amino-1,3-benzothiazol-4-yl)but-3-ynenitrile?
The canonical SMILES for 4-(2-amino-1,3-benzothiazol-4-yl)but-3-ynenitrile is N#CCC#Cc1cccc2sc(N)nc12.
What is the InChIKey of 4-(2-amino-1,3-benzothiazol-4-yl)but-3-ynenitrile?
The InChIKey is QAEKMJKLBXOYJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7N3S/c12-7-2-1-4-8-5-3-6-9-10(8)14-11(13)15-9/h3,5-6H,2H2,(H2,13,14).
What are the key properties of 4-(2-amino-1,3-benzothiazol-4-yl)but-3-ynenitrile?
4-(2-amino-1,3-benzothiazol-4-yl)but-3-ynenitrile has a molecular weight of 213.26 g/mol, XLogP of 2.14, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-amino-1,3-benzothiazol-4-yl)but-3-ynenitrile is sourced from PubChem (CID 170474983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).