About 4-[5-(hydroxymethyl)-1,3-thiazol-2-yl]but-3-en-1-ol
4-[5-(hydroxymethyl)-1,3-thiazol-2-yl]but-3-en-1-ol (PubChem CID 170476052) has the molecular formula C8H11NO2S
and a molecular weight of 185.25 g/mol. Its IUPAC name is 4-[5-(hydroxymethyl)-1,3-thiazol-2-yl]but-3-en-1-ol.
Molecular Properties
| Compound Name | 4-[5-(hydroxymethyl)-1,3-thiazol-2-yl]but-3-en-1-ol |
| PubChem CID | 170476052 |
| Molecular Formula | C8H11NO2S |
| Molecular Weight | 185.25 g/mol |
| Exact Mass | 185.05 |
| IUPAC Name | 4-[5-(hydroxymethyl)-1,3-thiazol-2-yl]but-3-en-1-ol |
| SMILES | OCCC=Cc1ncc(CO)s1 |
| InChI | InChI=1S/C8H11NO2S/c10-4-2-1-3-8-9-5-7(6-11)12-8/h1,3,5,10-11H,2,4,6H2 |
| InChIKey | RNPMIAVZJSMIRZ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.25 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[5-(hydroxymethyl)-1,3-thiazol-2-yl]but-3-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-(hydroxymethyl)-1,3-thiazol-2-yl]but-3-en-1-ol?
The IUPAC name of 4-[5-(hydroxymethyl)-1,3-thiazol-2-yl]but-3-en-1-ol (CID 170476052) is 4-[5-(hydroxymethyl)-1,3-thiazol-2-yl]but-3-en-1-ol.
What is the SMILES notation for 4-[5-(hydroxymethyl)-1,3-thiazol-2-yl]but-3-en-1-ol?
The canonical SMILES for 4-[5-(hydroxymethyl)-1,3-thiazol-2-yl]but-3-en-1-ol is OCCC=Cc1ncc(CO)s1.
What is the InChIKey of 4-[5-(hydroxymethyl)-1,3-thiazol-2-yl]but-3-en-1-ol?
The InChIKey is RNPMIAVZJSMIRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO2S/c10-4-2-1-3-8-9-5-7(6-11)12-8/h1,3,5,10-11H,2,4,6H2.
What are the key properties of 4-[5-(hydroxymethyl)-1,3-thiazol-2-yl]but-3-en-1-ol?
4-[5-(hydroxymethyl)-1,3-thiazol-2-yl]but-3-en-1-ol has a molecular weight of 185.25 g/mol, XLogP of 1.03, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-(hydroxymethyl)-1,3-thiazol-2-yl]but-3-en-1-ol is sourced from PubChem (CID 170476052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).