About 4-(4-hydroxybut-1-enyl)-3,5-dimethylbenzonitrile
4-(4-hydroxybut-1-enyl)-3,5-dimethylbenzonitrile (PubChem CID 170476940) has the molecular formula C13H15NO
and a molecular weight of 201.27 g/mol. Its IUPAC name is 4-(4-hydroxybut-1-enyl)-3,5-dimethylbenzonitrile.
Molecular Properties
| Compound Name | 4-(4-hydroxybut-1-enyl)-3,5-dimethylbenzonitrile |
| PubChem CID | 170476940 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | 4-(4-hydroxybut-1-enyl)-3,5-dimethylbenzonitrile |
| SMILES | Cc1cc(C#N)cc(C)c1C=CCCO |
| InChI | InChI=1S/C13H15NO/c1-10-7-12(9-14)8-11(2)13(10)5-3-4-6-15/h3,5,7-8,15H,4,6H2,1-2H3 |
| InChIKey | QBROYEDNKBKSBM-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(4-hydroxybut-1-enyl)-3,5-dimethylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-hydroxybut-1-enyl)-3,5-dimethylbenzonitrile?
The IUPAC name of 4-(4-hydroxybut-1-enyl)-3,5-dimethylbenzonitrile (CID 170476940) is 4-(4-hydroxybut-1-enyl)-3,5-dimethylbenzonitrile.
What is the SMILES notation for 4-(4-hydroxybut-1-enyl)-3,5-dimethylbenzonitrile?
The canonical SMILES for 4-(4-hydroxybut-1-enyl)-3,5-dimethylbenzonitrile is Cc1cc(C#N)cc(C)c1C=CCCO.
What is the InChIKey of 4-(4-hydroxybut-1-enyl)-3,5-dimethylbenzonitrile?
The InChIKey is QBROYEDNKBKSBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO/c1-10-7-12(9-14)8-11(2)13(10)5-3-4-6-15/h3,5,7-8,15H,4,6H2,1-2H3.
What are the key properties of 4-(4-hydroxybut-1-enyl)-3,5-dimethylbenzonitrile?
4-(4-hydroxybut-1-enyl)-3,5-dimethylbenzonitrile has a molecular weight of 201.27 g/mol, XLogP of 2.57, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-hydroxybut-1-enyl)-3,5-dimethylbenzonitrile is sourced from PubChem (CID 170476940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).