C11H13NO3 — CID 170476987
2-hydroxy-5-(4-hydroxybut-1-enyl)benzamide (PubChem CID 170476987) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is 2-hydroxy-5-(4-hydroxybut-1-enyl)benzamide.
| Compound Name | 2-hydroxy-5-(4-hydroxybut-1-enyl)benzamide |
|---|---|
| PubChem CID | 170476987 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 2-hydroxy-5-(4-hydroxybut-1-enyl)benzamide |
| SMILES | NC(=O)c1cc(C=CCCO)ccc1O |
| InChI | InChI=1S/C11H13NO3/c12-11(15)9-7-8(3-1-2-6-13)4-5-10(9)14/h1,3-5,7,13-14H,2,6H2,(H2,12,15) |
| InChIKey | QLMKQQSZDRDCFJ-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |