C23H22IN5O2S — CID 17047779
N-(furan-2-ylmethyl)-3-[[5-[(4-iodoanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]propanamide (PubChem CID 17047779) has the molecular formula C23H22IN5O2S and a molecular weight of 559.43 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-3-[[5-[(4-iodoanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]propanamide.
| Compound Name | N-(furan-2-ylmethyl)-3-[[5-[(4-iodoanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 17047779 |
| Molecular Formula | C23H22IN5O2S |
| Molecular Weight | 559.43 g/mol |
| Exact Mass | 559.05 |
| IUPAC Name | N-(furan-2-ylmethyl)-3-[[5-[(4-iodoanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]propanamide |
| SMILES | O=C(CCSc1nnc(CNc2ccc(I)cc2)n1-c1ccccc1)NCc1ccco1 |
| InChI | InChI=1S/C23H22IN5O2S/c24-17-8-10-18(11-9-17)25-16-21-27-28-23(29(21)19-5-2-1-3-6-19)32-14-12-22(30)26-15-20-7-4-13-31-20/h1-11,13,25H,12,14-16H2,(H,26,30) |
| InChIKey | STQPGJKQZCWOEK-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 84.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.43 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|