C13H13NOS — CID 170479089
4-[4-(1,2-oxazol-5-yl)phenyl]but-3-ene-1-thiol (PubChem CID 170479089) has the molecular formula C13H13NOS and a molecular weight of 231.32 g/mol. Its IUPAC name is 4-[4-(1,2-oxazol-5-yl)phenyl]but-3-ene-1-thiol.
| Compound Name | 4-[4-(1,2-oxazol-5-yl)phenyl]but-3-ene-1-thiol |
|---|---|
| PubChem CID | 170479089 |
| Molecular Formula | C13H13NOS |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | 4-[4-(1,2-oxazol-5-yl)phenyl]but-3-ene-1-thiol |
| SMILES | SCCC=Cc1ccc(-c2ccno2)cc1 |
| InChI | InChI=1S/C13H13NOS/c16-10-2-1-3-11-4-6-12(7-5-11)13-8-9-14-15-13/h1,3-9,16H,2,10H2 |
| InChIKey | HRKIRBWCRXFNJW-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 26.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|