C27H22FN3O5 — CID 17047964
3-[(4-fluorobenzoyl)amino]-N-[(E)-[5-[(4-methoxyphenyl)methoxy]furan-2-yl]methylideneamino]benzamide (PubChem CID 17047964) has the molecular formula C27H22FN3O5 and a molecular weight of 487.49 g/mol. Its IUPAC name is 3-[(4-fluorobenzoyl)amino]-N-[(E)-[5-[(4-methoxyphenyl)methoxy]furan-2-yl]methylideneamino]benzamide.
| Compound Name | 3-[(4-fluorobenzoyl)amino]-N-[(E)-[5-[(4-methoxyphenyl)methoxy]furan-2-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 17047964 |
| Molecular Formula | C27H22FN3O5 |
| Molecular Weight | 487.49 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | 3-[(4-fluorobenzoyl)amino]-N-[(E)-[5-[(4-methoxyphenyl)methoxy]furan-2-yl]methylideneamino]benzamide |
| SMILES | COc1ccc(COc2ccc(/C=N/NC(=O)c3cccc(NC(=O)c4ccc(F)cc4)c3)o2)cc1 |
| InChI | InChI=1S/C27H22FN3O5/c1-34-23-11-5-18(6-12-23)17-35-25-14-13-24(36-25)16-29-31-27(33)20-3-2-4-22(15-20)30-26(32)19-7-9-21(28)10-8-19/h2-16H,17H2,1H3,(H,30,32)(H,31,33)/b29-16+ |
| InChIKey | AYECFZXLLOMGPW-MUFRIFMGSA-N |
| XLogP | 5.02 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.49 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|